C31H33Cl2IP2Si — CID 159295465
bis(11-chloro-5,6-dihydrobenzo[b][1]benzophosphepine);iodo(trimethyl)silane (PubChem CID 159295465) has the molecular formula C31H33Cl2IP2Si and a molecular weight of 693.45 g/mol. Its IUPAC name is bis(11-chloro-5,6-dihydrobenzo[b][1]benzophosphepine);iodo(trimethyl)silane.
| Compound Name | bis(11-chloro-5,6-dihydrobenzo[b][1]benzophosphepine);iodo(trimethyl)silane |
|---|---|
| PubChem CID | 159295465 |
| Molecular Formula | C31H33Cl2IP2Si |
| Molecular Weight | 693.45 g/mol |
| Exact Mass | 692.02 |
| IUPAC Name | bis(11-chloro-5,6-dihydrobenzo[b][1]benzophosphepine);iodo(trimethyl)silane |
| SMILES | C[Si](C)(C)I.ClP1c2ccccc2CCc2ccccc21.ClP1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/2C14H12ClP.C3H9ISi/c2*15-16-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)16;1-5(2,3)4/h2*1-8H,9-10H2;1-3H3 |
| InChIKey | LAQSVKVOTSLYHJ-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.45 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|