C14H23NO — CID 178025100
ethane;5-ethyl-4-methyl-3,5-dihydro-2H-1,4-benzoxazepine (PubChem CID 178025100) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is ethane;5-ethyl-4-methyl-3,5-dihydro-2H-1,4-benzoxazepine.
| Compound Name | ethane;5-ethyl-4-methyl-3,5-dihydro-2H-1,4-benzoxazepine |
|---|---|
| PubChem CID | 178025100 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | ethane;5-ethyl-4-methyl-3,5-dihydro-2H-1,4-benzoxazepine |
| SMILES | CC.CCC1c2ccccc2OCCN1C |
| InChI | InChI=1S/C12H17NO.C2H6/c1-3-11-10-6-4-5-7-12(10)14-9-8-13(11)2;1-2/h4-7,11H,3,8-9H2,1-2H3;1-2H3 |
| InChIKey | QHFSILBKNUMWAR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |