About ethene;N-ethylideneethanimidamide;niobium
ethene;N-ethylideneethanimidamide;niobium (PubChem CID 178051970) has the molecular formula C6H11N2Nb-
and a molecular weight of 204.07 g/mol. Its IUPAC name is ethene;N-ethylideneethanimidamide;niobium.
Molecular Properties
| Compound Name | ethene;N-ethylideneethanimidamide;niobium |
| PubChem CID | 178051970 |
| Molecular Formula | C6H11N2Nb- |
| Molecular Weight | 204.07 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | ethene;N-ethylideneethanimidamide;niobium |
| SMILES | C=C.[H]/N=C([CH2-])/N=C/C.[Nb] |
| InChI | InChI=1S/C4H7N2.C2H4.Nb/c1-3-6-4(2)5;1-2;/h3,5H,2H2,1H3;1-2H2;/q-1;;/b5-4+,6-3+;; |
| InChIKey | SECDEEHNSXIZAM-SSEJERJKSA-N |
| XLogP | 1.69 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.07 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;N-ethylideneethanimidamide;niobium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;N-ethylideneethanimidamide;niobium?
The IUPAC name of ethene;N-ethylideneethanimidamide;niobium (CID 178051970) is ethene;N-ethylideneethanimidamide;niobium.
What is the SMILES notation for ethene;N-ethylideneethanimidamide;niobium?
The canonical SMILES for ethene;N-ethylideneethanimidamide;niobium is C=C.[H]/N=C([CH2-])/N=C/C.[Nb].
What is the InChIKey of ethene;N-ethylideneethanimidamide;niobium?
The InChIKey is SECDEEHNSXIZAM-SSEJERJKSA-N. The full InChI is InChI=1S/C4H7N2.C2H4.Nb/c1-3-6-4(2)5;1-2;/h3,5H,2H2,1H3;1-2H2;/q-1;;/b5-4+,6-3+;;.
What are the key properties of ethene;N-ethylideneethanimidamide;niobium?
ethene;N-ethylideneethanimidamide;niobium has a molecular weight of 204.07 g/mol, XLogP of 1.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;N-ethylideneethanimidamide;niobium is sourced from PubChem (CID 178051970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).