About 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine
1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine (PubChem CID 178069464) has the molecular formula C20H26N2O
and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine.
Molecular Properties
| Compound Name | 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine |
| PubChem CID | 178069464 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine |
| SMILES | CC1(C)C[C@@H](c2ccc(NNCc3ccccc3)cc2)CCO1 |
| InChI | InChI=1S/C20H26N2O/c1-20(2)14-18(12-13-23-20)17-8-10-19(11-9-17)22-21-15-16-6-4-3-5-7-16/h3-11,18,21-22H,12-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | MFNIFQZONWDNBF-SFHVURJKSA-N |
| XLogP | 4.48 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine?
The IUPAC name of 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine (CID 178069464) is 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine.
What is the SMILES notation for 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine?
The canonical SMILES for 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine is CC1(C)C[C@@H](c2ccc(NNCc3ccccc3)cc2)CCO1.
What is the InChIKey of 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine?
The InChIKey is MFNIFQZONWDNBF-SFHVURJKSA-N. The full InChI is InChI=1S/C20H26N2O/c1-20(2)14-18(12-13-23-20)17-8-10-19(11-9-17)22-21-15-16-6-4-3-5-7-16/h3-11,18,21-22H,12-15H2,1-2H3/t18-/m0/s1.
What are the key properties of 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine?
1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine has a molecular weight of 310.44 g/mol, XLogP of 4.48, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-[4-[(4S)-2,2-dimethyloxan-4-yl]phenyl]hydrazine is sourced from PubChem (CID 178069464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).