C20H29BF3NO5Si — CID 178073525
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one (PubChem CID 178073525) has the molecular formula C20H29BF3NO5Si and a molecular weight of 459.35 g/mol. Its IUPAC name is 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one.
| Compound Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 178073525 |
| Molecular Formula | C20H29BF3NO5Si |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one |
| SMILES | CC1(C)OB(c2ccc(C(F)(F)F)c3c2oc(=O)n3COCC[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C20H29BF3NO5Si/c1-18(2)19(3,4)30-21(29-18)14-9-8-13(20(22,23)24)15-16(14)28-17(26)25(15)12-27-10-11-31(5,6)7/h8-9H,10-12H2,1-7H3 |
| InChIKey | KPXGETVELNCVGR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|