C17H27N5O2 — CID 178105945
ethane;3,6,10-trimethyl-9-(5-methyloxolan-3-yl)-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene (PubChem CID 178105945) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is ethane;3,6,10-trimethyl-9-(5-methyloxolan-3-yl)-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene.
| Compound Name | ethane;3,6,10-trimethyl-9-(5-methyloxolan-3-yl)-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene |
|---|---|
| PubChem CID | 178105945 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | ethane;3,6,10-trimethyl-9-(5-methyloxolan-3-yl)-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene |
| SMILES | CC.Cc1nc2c3c(nn(C)c3n1)OCC(C)N2C1COC(C)C1 |
| InChI | InChI=1S/C15H21N5O2.C2H6/c1-8-6-22-15-12-13(19(4)18-15)16-10(3)17-14(12)20(8)11-5-9(2)21-7-11;1-2/h8-9,11H,5-7H2,1-4H3;1-2H3 |
| InChIKey | ZXWXJLPIESZTFI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |