C12H25NO — CID 178112792
ethane;(Z,2E)-5-(methylamino)-2-propylidenehex-3-en-1-ol (PubChem CID 178112792) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is ethane;(Z,2E)-5-(methylamino)-2-propylidenehex-3-en-1-ol.
| Compound Name | ethane;(Z,2E)-5-(methylamino)-2-propylidenehex-3-en-1-ol |
|---|---|
| PubChem CID | 178112792 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | ethane;(Z,2E)-5-(methylamino)-2-propylidenehex-3-en-1-ol |
| SMILES | CC.CC/C=C(\C=C/C(C)NC)CO |
| InChI | InChI=1S/C10H19NO.C2H6/c1-4-5-10(8-12)7-6-9(2)11-3;1-2/h5-7,9,11-12H,4,8H2,1-3H3;1-2H3/b7-6-,10-5+; |
| InChIKey | GHXAWIMVMHUAAX-LYKKQASXSA-N |
| XLogP | 2.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|