C48H93NO3 — CID 178131450
[(E)-9-[(12-butyl-11-methylideneoctadecyl)-(4-hydroxybutyl)amino]non-1-enyl] 2-butyloctanoate (PubChem CID 178131450) has the molecular formula C48H93NO3 and a molecular weight of 732.28 g/mol. Its IUPAC name is [(E)-9-[(12-butyl-11-methylideneoctadecyl)-(4-hydroxybutyl)amino]non-1-enyl] 2-butyloctanoate.
| Compound Name | [(E)-9-[(12-butyl-11-methylideneoctadecyl)-(4-hydroxybutyl)amino]non-1-enyl] 2-butyloctanoate |
|---|---|
| PubChem CID | 178131450 |
| Molecular Formula | C48H93NO3 |
| Molecular Weight | 732.28 g/mol |
| Exact Mass | 731.72 |
| IUPAC Name | [(E)-9-[(12-butyl-11-methylideneoctadecyl)-(4-hydroxybutyl)amino]non-1-enyl] 2-butyloctanoate |
| SMILES | C=C(CCCCCCCCCCN(CCCCO)CCCCCCC/C=C/OC(=O)C(CCCC)CCCCCC)C(CCCC)CCCCCC |
| InChI | InChI=1S/C48H93NO3/c1-6-10-14-28-38-46(36-12-8-3)45(5)35-27-23-19-16-17-20-24-30-40-49(42-32-33-43-50)41-31-25-21-18-22-26-34-44-52-48(51)47(37-13-9-4)39-29-15-11-7-2/h34,44,46-47,50H,5-33,35-43H2,1-4H3/b44-34+ |
| InChIKey | DUKRQBPSBHRMPS-WTCPEQCQSA-N |
| XLogP | 15.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.28 |
| LogP ≤ 5 | 15.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|