C23H25FN2O3 — CID 178149286
1-[(2R)-4-[(2R)-2-(3-fluoro-4-methylphenyl)-2-phenoxyacetyl]-2-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 178149286) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is 1-[(2R)-4-[(2R)-2-(3-fluoro-4-methylphenyl)-2-phenoxyacetyl]-2-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-4-[(2R)-2-(3-fluoro-4-methylphenyl)-2-phenoxyacetyl]-2-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 178149286 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[(2R)-4-[(2R)-2-(3-fluoro-4-methylphenyl)-2-phenoxyacetyl]-2-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=O)[C@H](Oc2ccccc2)c2ccc(C)c(F)c2)C[C@H]1C |
| InChI | InChI=1S/C23H25FN2O3/c1-4-21(27)26-13-12-25(15-17(26)3)23(28)22(29-19-8-6-5-7-9-19)18-11-10-16(2)20(24)14-18/h4-11,14,17,22H,1,12-13,15H2,2-3H3/t17-,22-/m1/s1 |
| InChIKey | GYKWBXNPQJOSRM-VGOFRKELSA-N |
| XLogP | 3.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|