C12H20O — CID 178166362
1-cyclopropyloxy-4-methylcyclohexa-1,3-diene;ethane (PubChem CID 178166362) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-cyclopropyloxy-4-methylcyclohexa-1,3-diene;ethane.
| Compound Name | 1-cyclopropyloxy-4-methylcyclohexa-1,3-diene;ethane |
|---|---|
| PubChem CID | 178166362 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 1-cyclopropyloxy-4-methylcyclohexa-1,3-diene;ethane |
| SMILES | CC.CC1=CC=C(OC2CC2)CC1 |
| InChI | InChI=1S/C10H14O.C2H6/c1-8-2-4-9(5-3-8)11-10-6-7-10;1-2/h2,4,10H,3,5-7H2,1H3;1-2H3 |
| InChIKey | CCYCMKFFAHQSDB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |