C20H28O5 — CID 178184638
3-[(2S,5S)-4-oxo-5-(phenylmethoxymethyl)oxolan-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 178184638) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is 3-[(2S,5S)-4-oxo-5-(phenylmethoxymethyl)oxolan-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(2S,5S)-4-oxo-5-(phenylmethoxymethyl)oxolan-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 178184638 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 3-[(2S,5S)-4-oxo-5-(phenylmethoxymethyl)oxolan-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCC[C@H]1CC(=O)[C@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C20H28O5/c1-20(2,3)19(22)24-11-7-10-16-12-17(21)18(25-16)14-23-13-15-8-5-4-6-9-15/h4-6,8-9,16,18H,7,10-14H2,1-3H3/t16-,18-/m0/s1 |
| InChIKey | CLZRLNIYMKQHJI-WMZOPIPTSA-N |
| XLogP | 3.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|