C25H25N3O4 — CID 18285591
[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-methoxy-1-phenylpyrazole-3-carboxylate (PubChem CID 18285591) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-methoxy-1-phenylpyrazole-3-carboxylate.
| Compound Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-methoxy-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 18285591 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-methoxy-1-phenylpyrazole-3-carboxylate |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)OCC(=O)/C=C1\N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C25H25N3O4/c1-25(2)19-12-8-9-13-20(19)27(3)22(25)14-18(29)16-32-24(30)23-21(31-4)15-28(26-23)17-10-6-5-7-11-17/h5-15H,16H2,1-4H3/b22-14- |
| InChIKey | NOLLUCRROSIPIA-HMAPJEAMSA-N |
| XLogP | 3.92 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|