C20H32ClN5OS — CID 18326570
1-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]-3-nonylurea;hydrochloride (PubChem CID 18326570) has the molecular formula C20H32ClN5OS and a molecular weight of 426.03 g/mol. Its IUPAC name is 1-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]-3-nonylurea;hydrochloride.
| Compound Name | 1-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]-3-nonylurea;hydrochloride |
|---|---|
| PubChem CID | 18326570 |
| Molecular Formula | C20H32ClN5OS |
| Molecular Weight | 426.03 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 1-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]-3-nonylurea;hydrochloride |
| SMILES | C=CCNc1nc(NC(=O)NCCCCCCCCC)c2scc(C)c2n1.Cl |
| InChI | InChI=1S/C20H31N5OS.ClH/c1-4-6-7-8-9-10-11-13-22-20(26)25-18-17-16(15(3)14-27-17)23-19(24-18)21-12-5-2;/h5,14H,2,4,6-13H2,1,3H3,(H3,21,22,23,24,25,26);1H |
| InChIKey | CCHNWBKKYKUYRO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.03 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|