C21H32N3O6P — CID 18338850
N-(diethoxyphosphorylmethyl)-4-methyl-2-(3-methyl-2,5-dioxo-1,3-dihydro-1,4-benzodiazepin-4-yl)pentanamide (PubChem CID 18338850) has the molecular formula C21H32N3O6P and a molecular weight of 453.48 g/mol. Its IUPAC name is N-(diethoxyphosphorylmethyl)-4-methyl-2-(3-methyl-2,5-dioxo-1,3-dihydro-1,4-benzodiazepin-4-yl)pentanamide.
| Compound Name | N-(diethoxyphosphorylmethyl)-4-methyl-2-(3-methyl-2,5-dioxo-1,3-dihydro-1,4-benzodiazepin-4-yl)pentanamide |
|---|---|
| PubChem CID | 18338850 |
| Molecular Formula | C21H32N3O6P |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | N-(diethoxyphosphorylmethyl)-4-methyl-2-(3-methyl-2,5-dioxo-1,3-dihydro-1,4-benzodiazepin-4-yl)pentanamide |
| SMILES | CCOP(=O)(CNC(=O)C(CC(C)C)N1C(=O)c2ccccc2NC(=O)C1C)OCC |
| InChI | InChI=1S/C21H32N3O6P/c1-6-29-31(28,30-7-2)13-22-20(26)18(12-14(3)4)24-15(5)19(25)23-17-11-9-8-10-16(17)21(24)27/h8-11,14-15,18H,6-7,12-13H2,1-5H3,(H,22,26)(H,23,25) |
| InChIKey | YILIGPFNVIHMOJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|