C12H22O3SSi — CID 18401981
3-tris(prop-1-en-2-yloxy)silylpropane-1-thiol (PubChem CID 18401981) has the molecular formula C12H22O3SSi and a molecular weight of 274.46 g/mol. Its IUPAC name is 3-tris(prop-1-en-2-yloxy)silylpropane-1-thiol.
| Compound Name | 3-tris(prop-1-en-2-yloxy)silylpropane-1-thiol |
|---|---|
| PubChem CID | 18401981 |
| Molecular Formula | C12H22O3SSi |
| Molecular Weight | 274.46 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-tris(prop-1-en-2-yloxy)silylpropane-1-thiol |
| SMILES | C=C(C)O[Si](CCCS)(OC(=C)C)OC(=C)C |
| InChI | InChI=1S/C12H22O3SSi/c1-10(2)13-17(9-7-8-16,14-11(3)4)15-12(5)6/h16H,1,3,5,7-9H2,2,4,6H3 |
| InChIKey | LXMRIRQDAGGRRG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|