About (2-acetyloxyphenyl) 2-piperazin-1-ylacetate
(2-acetyloxyphenyl) 2-piperazin-1-ylacetate (PubChem CID 18423251) has the molecular formula C14H18N2O4
and a molecular weight of 278.31 g/mol. Its IUPAC name is (2-acetyloxyphenyl) 2-piperazin-1-ylacetate.
Molecular Properties
| Compound Name | (2-acetyloxyphenyl) 2-piperazin-1-ylacetate |
| PubChem CID | 18423251 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2-acetyloxyphenyl) 2-piperazin-1-ylacetate |
| SMILES | CC(=O)Oc1ccccc1OC(=O)CN1CCNCC1 |
| InChI | InChI=1S/C14H18N2O4/c1-11(17)19-12-4-2-3-5-13(12)20-14(18)10-16-8-6-15-7-9-16/h2-5,15H,6-10H2,1H3 |
| InChIKey | BQQIZPBPWABFMD-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-acetyloxyphenyl) 2-piperazin-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetyloxyphenyl) 2-piperazin-1-ylacetate?
The IUPAC name of (2-acetyloxyphenyl) 2-piperazin-1-ylacetate (CID 18423251) is (2-acetyloxyphenyl) 2-piperazin-1-ylacetate.
What is the SMILES notation for (2-acetyloxyphenyl) 2-piperazin-1-ylacetate?
The canonical SMILES for (2-acetyloxyphenyl) 2-piperazin-1-ylacetate is CC(=O)Oc1ccccc1OC(=O)CN1CCNCC1.
What is the InChIKey of (2-acetyloxyphenyl) 2-piperazin-1-ylacetate?
The InChIKey is BQQIZPBPWABFMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O4/c1-11(17)19-12-4-2-3-5-13(12)20-14(18)10-16-8-6-15-7-9-16/h2-5,15H,6-10H2,1H3.
What are the key properties of (2-acetyloxyphenyl) 2-piperazin-1-ylacetate?
(2-acetyloxyphenyl) 2-piperazin-1-ylacetate has a molecular weight of 278.31 g/mol, XLogP of 0.42, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetyloxyphenyl) 2-piperazin-1-ylacetate is sourced from PubChem (CID 18423251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).