C26H23N3O5S — CID 18461405
5-[[4-[1-[6-(4-hydroxy-2-methylphenoxy)-1H-benzimidazol-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 18461405) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is 5-[[4-[1-[6-(4-hydroxy-2-methylphenoxy)-1H-benzimidazol-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[1-[6-(4-hydroxy-2-methylphenoxy)-1H-benzimidazol-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18461405 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 5-[[4-[1-[6-(4-hydroxy-2-methylphenoxy)-1H-benzimidazol-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(O)ccc1Oc1ccc2nc(C(C)Oc3ccc(CC4SC(=O)NC4=O)cc3)[nH]c2c1 |
| InChI | InChI=1S/C26H23N3O5S/c1-14-11-17(30)5-10-22(14)34-19-8-9-20-21(13-19)28-24(27-20)15(2)33-18-6-3-16(4-7-18)12-23-25(31)29-26(32)35-23/h3-11,13,15,23,30H,12H2,1-2H3,(H,27,28)(H,29,31,32) |
| InChIKey | MEKKRQCXVIDUQJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|