C24H25ClN4O3S — CID 18467566
1-[(4-chloroisoquinolin-3-yl)methyl]-2-methyl-N-pentylsulfonylbenzimidazole-4-carboxamide (PubChem CID 18467566) has the molecular formula C24H25ClN4O3S and a molecular weight of 485.01 g/mol. Its IUPAC name is 1-[(4-chloroisoquinolin-3-yl)methyl]-2-methyl-N-pentylsulfonylbenzimidazole-4-carboxamide.
| Compound Name | 1-[(4-chloroisoquinolin-3-yl)methyl]-2-methyl-N-pentylsulfonylbenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 18467566 |
| Molecular Formula | C24H25ClN4O3S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 1-[(4-chloroisoquinolin-3-yl)methyl]-2-methyl-N-pentylsulfonylbenzimidazole-4-carboxamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)c1cccc2c1nc(C)n2Cc1ncc2ccccc2c1Cl |
| InChI | InChI=1S/C24H25ClN4O3S/c1-3-4-7-13-33(31,32)28-24(30)19-11-8-12-21-23(19)27-16(2)29(21)15-20-22(25)18-10-6-5-9-17(18)14-26-20/h5-6,8-12,14H,3-4,7,13,15H2,1-2H3,(H,28,30) |
| InChIKey | ACIPMHMNTYXXRC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|