C23H27N5O4S2 — CID 174362425
3-[[2-methyl-6-[(pentylsulfonylamino)-sulfinoamino]benzimidazol-1-yl]methyl]isoquinoline (PubChem CID 174362425) has the molecular formula C23H27N5O4S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 3-[[2-methyl-6-[(pentylsulfonylamino)-sulfinoamino]benzimidazol-1-yl]methyl]isoquinoline.
| Compound Name | 3-[[2-methyl-6-[(pentylsulfonylamino)-sulfinoamino]benzimidazol-1-yl]methyl]isoquinoline |
|---|---|
| PubChem CID | 174362425 |
| Molecular Formula | C23H27N5O4S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 3-[[2-methyl-6-[(pentylsulfonylamino)-sulfinoamino]benzimidazol-1-yl]methyl]isoquinoline |
| SMILES | CCCCCS(=O)(=O)NN(c1ccc2nc(C)n(Cc3cc4ccccc4cn3)c2c1)S(=O)O |
| InChI | InChI=1S/C23H27N5O4S2/c1-3-4-7-12-34(31,32)26-28(33(29)30)21-10-11-22-23(14-21)27(17(2)25-22)16-20-13-18-8-5-6-9-19(18)15-24-20/h5-6,8-11,13-15,26H,3-4,7,12,16H2,1-2H3,(H,29,30) |
| InChIKey | VLQJNJCLNWBPID-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|