C29H28N4O — CID 18616674
4-[2-[4-(4-benzylanilino)quinazolin-6-yl]ethynyl]-1-methylpiperidin-4-ol (PubChem CID 18616674) has the molecular formula C29H28N4O and a molecular weight of 448.57 g/mol. Its IUPAC name is 4-[2-[4-(4-benzylanilino)quinazolin-6-yl]ethynyl]-1-methylpiperidin-4-ol.
| Compound Name | 4-[2-[4-(4-benzylanilino)quinazolin-6-yl]ethynyl]-1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 18616674 |
| Molecular Formula | C29H28N4O |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 4-[2-[4-(4-benzylanilino)quinazolin-6-yl]ethynyl]-1-methylpiperidin-4-ol |
| SMILES | CN1CCC(O)(C#Cc2ccc3ncnc(Nc4ccc(Cc5ccccc5)cc4)c3c2)CC1 |
| InChI | InChI=1S/C29H28N4O/c1-33-17-15-29(34,16-18-33)14-13-24-9-12-27-26(20-24)28(31-21-30-27)32-25-10-7-23(8-11-25)19-22-5-3-2-4-6-22/h2-12,20-21,34H,15-19H2,1H3,(H,30,31,32) |
| InChIKey | DIVKNHYLNQCBCV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|