C13H6N2O2 — CID 18625073
2-[(2,3-dioxo-1H-inden-1-yl)methylidene]propanedinitrile (PubChem CID 18625073) has the molecular formula C13H6N2O2 and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-[(2,3-dioxo-1H-inden-1-yl)methylidene]propanedinitrile.
| Compound Name | 2-[(2,3-dioxo-1H-inden-1-yl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 18625073 |
| Molecular Formula | C13H6N2O2 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 2-[(2,3-dioxo-1H-inden-1-yl)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CC1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C13H6N2O2/c14-6-8(7-15)5-11-9-3-1-2-4-10(9)12(16)13(11)17/h1-5,11H |
| InChIKey | YXPJQHRNYIOTQB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|