C29H34N4O2 — CID 18675250
3-[4-[[4-[[di(propan-2-yl)amino]methyl]phenyl]methyl]-3-oxo-1,4-benzoxazin-2-yl]benzenecarboximidamide (PubChem CID 18675250) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 3-[4-[[4-[[di(propan-2-yl)amino]methyl]phenyl]methyl]-3-oxo-1,4-benzoxazin-2-yl]benzenecarboximidamide.
| Compound Name | 3-[4-[[4-[[di(propan-2-yl)amino]methyl]phenyl]methyl]-3-oxo-1,4-benzoxazin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 18675250 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 3-[4-[[4-[[di(propan-2-yl)amino]methyl]phenyl]methyl]-3-oxo-1,4-benzoxazin-2-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C2Oc3ccccc3N(Cc3ccc(CN(C(C)C)C(C)C)cc3)C2=O)c1 |
| InChI | InChI=1S/C29H34N4O2/c1-19(2)32(20(3)4)17-21-12-14-22(15-13-21)18-33-25-10-5-6-11-26(25)35-27(29(33)34)23-8-7-9-24(16-23)28(30)31/h5-16,19-20,27H,17-18H2,1-4H3,(H3,30,31) |
| InChIKey | JYPFCXRECGQZGH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 82.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|