C28H39N5O2 — CID 70083731
3-[6-(aminomethyl)-4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]benzenecarboximidamide (PubChem CID 70083731) has the molecular formula C28H39N5O2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 3-[6-(aminomethyl)-4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]benzenecarboximidamide.
| Compound Name | 3-[6-(aminomethyl)-4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 70083731 |
| Molecular Formula | C28H39N5O2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 3-[6-(aminomethyl)-4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C2Oc3ccc(CN)cc3N(CCCCC[C@]3(C)CCC[C@H](C)N3)C2=O)c1 |
| InChI | InChI=1S/C28H39N5O2/c1-19-8-7-14-28(2,32-19)13-4-3-5-15-33-23-16-20(18-29)11-12-24(23)35-25(27(33)34)21-9-6-10-22(17-21)26(30)31/h6,9-12,16-17,19,25,32H,3-5,7-8,13-15,18,29H2,1-2H3,(H3,30,31)/t19-,25?,28+/m0/s1 |
| InChIKey | TYBLHTHHRVSIKD-PNJASMJJSA-N |
| XLogP | 4.38 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|