C28H37N3O2 — CID 59104535
4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-2-(3-ethanimidoylphenyl)-1,4-benzoxazin-3-one (PubChem CID 59104535) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is 4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-2-(3-ethanimidoylphenyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-2-(3-ethanimidoylphenyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 59104535 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | 4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-2-(3-ethanimidoylphenyl)-1,4-benzoxazin-3-one |
| SMILES | [H]/N=C(\C)c1cccc(C2Oc3ccccc3N(CCCCCN3[C@H](C)CCC[C@@H]3C)C2=O)c1 |
| InChI | InChI=1S/C28H37N3O2/c1-20-11-9-12-21(2)30(20)17-7-4-8-18-31-25-15-5-6-16-26(25)33-27(28(31)32)24-14-10-13-23(19-24)22(3)29/h5-6,10,13-16,19-21,27,29H,4,7-9,11-12,17-18H2,1-3H3/b29-22+/t20-,21+,27? |
| InChIKey | CWYNOVKTURKLLB-ZYLNRFTFSA-N |
| XLogP | 5.97 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|