C28H38N4OS — CID 23555423
3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-6-methyl-3-oxo-1,4-benzothiazin-2-yl]benzenecarboximidamide (PubChem CID 23555423) has the molecular formula C28H38N4OS and a molecular weight of 478.71 g/mol. Its IUPAC name is 3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-6-methyl-3-oxo-1,4-benzothiazin-2-yl]benzenecarboximidamide.
| Compound Name | 3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-6-methyl-3-oxo-1,4-benzothiazin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 23555423 |
| Molecular Formula | C28H38N4OS |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-6-methyl-3-oxo-1,4-benzothiazin-2-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C2Sc3ccc(C)cc3N(CCCCCN3[C@H](C)CCC[C@@H]3C)C2=O)c1 |
| InChI | InChI=1S/C28H38N4OS/c1-19-13-14-25-24(17-19)32(16-6-4-5-15-31-20(2)9-7-10-21(31)3)28(33)26(34-25)22-11-8-12-23(18-22)27(29)30/h8,11-14,17-18,20-21,26H,4-7,9-10,15-16H2,1-3H3,(H3,29,30)/t20-,21+,26? |
| InChIKey | RLGWSXDFLHICKZ-CPLAMXDQSA-N |
| XLogP | 5.89 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|