C34H43N5O4S — CID 23555318
3-[6-(benzylsulfonylamino)-4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]benzenecarboximidamide (PubChem CID 23555318) has the molecular formula C34H43N5O4S and a molecular weight of 617.82 g/mol. Its IUPAC name is 3-[6-(benzylsulfonylamino)-4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]benzenecarboximidamide.
| Compound Name | 3-[6-(benzylsulfonylamino)-4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 23555318 |
| Molecular Formula | C34H43N5O4S |
| Molecular Weight | 617.82 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | 3-[6-(benzylsulfonylamino)-4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C2Oc3ccc(NS(=O)(=O)Cc4ccccc4)cc3N(CCCCCN3[C@H](C)CCC[C@@H]3C)C2=O)c1 |
| InChI | InChI=1S/C34H43N5O4S/c1-24-11-9-12-25(2)38(24)19-7-4-8-20-39-30-22-29(37-44(41,42)23-26-13-5-3-6-14-26)17-18-31(30)43-32(34(39)40)27-15-10-16-28(21-27)33(35)36/h3,5-6,10,13-18,21-22,24-25,32,37H,4,7-9,11-12,19-20,23H2,1-2H3,(H3,35,36)/t24-,25+,32? |
| InChIKey | IEKOXBCGRGJEEE-FCLIONODSA-N |
| XLogP | 5.81 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.82 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|