C29H35F3N4O4 — CID 10745453
[(Z)-[amino-[3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]phenyl]methylidene]amino] 2,2,2-trifluoroacetate (PubChem CID 10745453) has the molecular formula C29H35F3N4O4 and a molecular weight of 560.62 g/mol. Its IUPAC name is [(Z)-[amino-[3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]phenyl]methylidene]amino] 2,2,2-trifluoroacetate.
| Compound Name | [(Z)-[amino-[3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]phenyl]methylidene]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10745453 |
| Molecular Formula | C29H35F3N4O4 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | [(Z)-[amino-[3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]phenyl]methylidene]amino] 2,2,2-trifluoroacetate |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCCN1C(=O)C(c2cccc(/C(N)=N/OC(=O)C(F)(F)F)c2)Oc2ccccc21 |
| InChI | InChI=1S/C29H35F3N4O4/c1-19-10-8-11-20(2)35(19)16-6-3-7-17-36-23-14-4-5-15-24(23)39-25(27(36)37)21-12-9-13-22(18-21)26(33)34-40-28(38)29(30,31)32/h4-5,9,12-15,18-20,25H,3,6-8,10-11,16-17H2,1-2H3,(H2,33,34)/t19-,20+,25? |
| InChIKey | RZQDOHYQJJLMDK-WPUZRXDDSA-N |
| XLogP | 5.31 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|