C25H34N4O2 — CID 23555267
2-(4-amino-3-pyridinyl)-4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzoxazin-3-one (PubChem CID 23555267) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-(4-amino-3-pyridinyl)-4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzoxazin-3-one.
| Compound Name | 2-(4-amino-3-pyridinyl)-4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23555267 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 2-(4-amino-3-pyridinyl)-4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzoxazin-3-one |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCCN1C(=O)C(c2cnccc2N)Oc2ccccc21 |
| InChI | InChI=1S/C25H34N4O2/c1-18-9-8-10-19(2)28(18)15-6-3-7-16-29-22-11-4-5-12-23(22)31-24(25(29)30)20-17-27-14-13-21(20)26/h4-5,11-14,17-19,24H,3,6-10,15-16H2,1-2H3,(H2,26,27)/t18-,19+,24? |
| InChIKey | WCRUXTYQIIQULG-QRQCMCJISA-N |
| XLogP | 4.56 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|