C24H33N5O2 — CID 23555270
2-(6-aminopyrazin-2-yl)-4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzoxazin-3-one (PubChem CID 23555270) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-(6-aminopyrazin-2-yl)-4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzoxazin-3-one.
| Compound Name | 2-(6-aminopyrazin-2-yl)-4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23555270 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 2-(6-aminopyrazin-2-yl)-4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzoxazin-3-one |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCCN1C(=O)C(c2cncc(N)n2)Oc2ccccc21 |
| InChI | InChI=1S/C24H33N5O2/c1-17-9-8-10-18(2)28(17)13-6-3-7-14-29-20-11-4-5-12-21(20)31-23(24(29)30)19-15-26-16-22(25)27-19/h4-5,11-12,15-18,23H,3,6-10,13-14H2,1-2H3,(H2,25,27)/t17-,18+,23? |
| InChIKey | RGTXGMUIDURXFE-NHJWOMDBSA-N |
| XLogP | 3.96 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|