C26H40N4O2 — CID 70083856
3-[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]cyclopentane-1-carboximidamide (PubChem CID 70083856) has the molecular formula C26H40N4O2 and a molecular weight of 440.63 g/mol. Its IUPAC name is 3-[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]cyclopentane-1-carboximidamide.
| Compound Name | 3-[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]cyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 70083856 |
| Molecular Formula | C26H40N4O2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.32 |
| IUPAC Name | 3-[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]cyclopentane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCC(C2Oc3ccccc3N(CCCCC[C@]3(C)CCC[C@H](C)N3)C2=O)C1 |
| InChI | InChI=1S/C26H40N4O2/c1-18-9-8-15-26(2,29-18)14-6-3-7-16-30-21-10-4-5-11-22(21)32-23(25(30)31)19-12-13-20(17-19)24(27)28/h4-5,10-11,18-20,23,29H,3,6-9,12-17H2,1-2H3,(H3,27,28)/t18-,19?,20?,23?,26+/m0/s1 |
| InChIKey | XFHONVYJKGLABL-PTTKTIPSSA-N |
| XLogP | 4.61 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|