C13H23NO3 — CID 18705365
2-[2-(4-methylpentan-2-ylideneamino)ethoxy]ethyl prop-2-enoate (PubChem CID 18705365) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-[2-(4-methylpentan-2-ylideneamino)ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-(4-methylpentan-2-ylideneamino)ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 18705365 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 2-[2-(4-methylpentan-2-ylideneamino)ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCC/N=C(\C)CC(C)C |
| InChI | InChI=1S/C13H23NO3/c1-5-13(15)17-9-8-16-7-6-14-12(4)10-11(2)3/h5,11H,1,6-10H2,2-4H3/b14-12+ |
| InChIKey | XJGDRYIWKAXCNF-WYMLVPIESA-N |
| XLogP | 2.24 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|