C17H26O3 — CID 18725475
3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-2-methylbutan-2-ol (PubChem CID 18725475) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-2-methylbutan-2-ol.
| Compound Name | 3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 18725475 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 3-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]-2-methylbutan-2-ol |
| SMILES | C/C=C/COc1cc(C)c(OC(C)C(C)(C)O)c(C)c1 |
| InChI | InChI=1S/C17H26O3/c1-7-8-9-19-15-10-12(2)16(13(3)11-15)20-14(4)17(5,6)18/h7-8,10-11,14,18H,9H2,1-6H3/b8-7+ |
| InChIKey | GAPXKVLYIJCGHV-BQYQJAHWSA-N |
| XLogP | 3.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|