C39H64N2O6S2 — CID 18730631
2-[4-[2-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethylamino]pent-4-enyldisulfanyl]butanedioic acid (PubChem CID 18730631) has the molecular formula C39H64N2O6S2 and a molecular weight of 721.08 g/mol. Its IUPAC name is 2-[4-[2-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethylamino]pent-4-enyldisulfanyl]butanedioic acid.
| Compound Name | 2-[4-[2-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethylamino]pent-4-enyldisulfanyl]butanedioic acid |
|---|---|
| PubChem CID | 18730631 |
| Molecular Formula | C39H64N2O6S2 |
| Molecular Weight | 721.08 g/mol |
| Exact Mass | 720.42 |
| IUPAC Name | 2-[4-[2-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethylamino]pent-4-enyldisulfanyl]butanedioic acid |
| SMILES | C=C(CCCSSC(CC(=O)O)C(=O)O)NCCNC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C39H64N2O6S2/c1-25(2)9-7-10-26(3)31-14-15-32-30-13-12-28-23-29(16-18-38(28,5)33(30)17-19-39(31,32)6)47-37(46)41-21-20-40-27(4)11-8-22-48-49-34(36(44)45)24-35(42)43/h12,25-26,29-34,40H,4,7-11,13-24H2,1-3,5-6H3,(H,41,46)(H,42,43)(H,44,45) |
| InChIKey | VVPWLRVIYVAAGX-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.08 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|