C13H13N3O — CID 18730779
4-(2,2-diisocyanoethenyl)-3-methoxy-N,N-dimethylaniline (PubChem CID 18730779) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-(2,2-diisocyanoethenyl)-3-methoxy-N,N-dimethylaniline.
| Compound Name | 4-(2,2-diisocyanoethenyl)-3-methoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 18730779 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-(2,2-diisocyanoethenyl)-3-methoxy-N,N-dimethylaniline |
| SMILES | [C-]#[N+]C(=Cc1ccc(N(C)C)cc1OC)[N+]#[C-] |
| InChI | InChI=1S/C13H13N3O/c1-14-13(15-2)8-10-6-7-11(16(3)4)9-12(10)17-5/h6-9H,3-5H3 |
| InChIKey | QCJTWZHYMROVHU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 21.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|