C4H4KN3O2S — CID 18739531
potassium 2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)acetate (PubChem CID 18739531) has the molecular formula C4H4KN3O2S and a molecular weight of 197.26 g/mol. Its IUPAC name is potassium 2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)acetate.
| Compound Name | potassium 2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)acetate |
|---|---|
| PubChem CID | 18739531 |
| Molecular Formula | C4H4KN3O2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 196.97 |
| IUPAC Name | potassium 2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)acetate |
| SMILES | O=C([O-])Cc1nc(=S)[nH][nH]1.[K+] |
| InChI | InChI=1S/C4H5N3O2S.K/c8-3(9)1-2-5-4(10)7-6-2;/h1H2,(H,8,9)(H2,5,6,7,10);/q;+1/p-1 |
| InChIKey | PDKBTRRGLPRZSQ-UHFFFAOYSA-M |
| XLogP | -4.24 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | -4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|