C13H13F3O5S — CID 18770876
2-[3-(trifluoromethylsulfonyloxy)-5,6,7,8-tetrahydronaphthalen-1-yl]acetic acid (PubChem CID 18770876) has the molecular formula C13H13F3O5S and a molecular weight of 338.30 g/mol. Its IUPAC name is 2-[3-(trifluoromethylsulfonyloxy)-5,6,7,8-tetrahydronaphthalen-1-yl]acetic acid.
| Compound Name | 2-[3-(trifluoromethylsulfonyloxy)-5,6,7,8-tetrahydronaphthalen-1-yl]acetic acid |
|---|---|
| PubChem CID | 18770876 |
| Molecular Formula | C13H13F3O5S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 2-[3-(trifluoromethylsulfonyloxy)-5,6,7,8-tetrahydronaphthalen-1-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(OS(=O)(=O)C(F)(F)F)cc2c1CCCC2 |
| InChI | InChI=1S/C13H13F3O5S/c14-13(15,16)22(19,20)21-10-5-8-3-1-2-4-11(8)9(6-10)7-12(17)18/h5-6H,1-4,7H2,(H,17,18) |
| InChIKey | FXEPCZDVANMTLM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|