C40H32F6Si — CID 18792369
1-tert-butyl-1,3,4-triphenyl-2,5-bis[2-(trifluoromethyl)phenyl]silole (PubChem CID 18792369) has the molecular formula C40H32F6Si and a molecular weight of 654.77 g/mol. Its IUPAC name is 1-tert-butyl-1,3,4-triphenyl-2,5-bis[2-(trifluoromethyl)phenyl]silole.
| Compound Name | 1-tert-butyl-1,3,4-triphenyl-2,5-bis[2-(trifluoromethyl)phenyl]silole |
|---|---|
| PubChem CID | 18792369 |
| Molecular Formula | C40H32F6Si |
| Molecular Weight | 654.77 g/mol |
| Exact Mass | 654.22 |
| IUPAC Name | 1-tert-butyl-1,3,4-triphenyl-2,5-bis[2-(trifluoromethyl)phenyl]silole |
| SMILES | CC(C)(C)[Si]1(c2ccccc2)C(c2ccccc2C(F)(F)F)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C40H32F6Si/c1-38(2,3)47(29-21-11-6-12-22-29)36(30-23-13-15-25-32(30)39(41,42)43)34(27-17-7-4-8-18-27)35(28-19-9-5-10-20-28)37(47)31-24-14-16-26-33(31)40(44,45)46/h4-26H,1-3H3 |
| InChIKey | VWMVRGLFAOBUSA-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.77 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|