C15H26O4-2 — CID 18794999
2,2-di(propan-2-yl)nonanedioate (PubChem CID 18794999) has the molecular formula C15H26O4-2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2,2-di(propan-2-yl)nonanedioate.
| Compound Name | 2,2-di(propan-2-yl)nonanedioate |
|---|---|
| PubChem CID | 18794999 |
| Molecular Formula | C15H26O4-2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2,2-di(propan-2-yl)nonanedioate |
| SMILES | CC(C)C(CCCCCCC(=O)[O-])(C(=O)[O-])C(C)C |
| InChI | InChI=1S/C15H28O4/c1-11(2)15(12(3)4,14(18)19)10-8-6-5-7-9-13(16)17/h11-12H,5-10H2,1-4H3,(H,16,17)(H,18,19)/p-2 |
| InChIKey | FMFFBDRWUPBADI-UHFFFAOYSA-L |
| XLogP | 1.13 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|