C28H30N4O3S2 — CID 18812638
N-(4-methoxyphenyl)-4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine (PubChem CID 18812638) has the molecular formula C28H30N4O3S2 and a molecular weight of 534.71 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine.
| Compound Name | N-(4-methoxyphenyl)-4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 18812638 |
| Molecular Formula | C28H30N4O3S2 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | N-(4-methoxyphenyl)-4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(/N=c2\scc(-c3ccc(S(=O)(=O)N4CCC(C)CC4)cc3)n2Cc2cccnc2)cc1 |
| InChI | InChI=1S/C28H30N4O3S2/c1-21-13-16-31(17-14-21)37(33,34)26-11-5-23(6-12-26)27-20-36-28(30-24-7-9-25(35-2)10-8-24)32(27)19-22-4-3-15-29-18-22/h3-12,15,18,20-21H,13-14,16-17,19H2,1-2H3/b30-28- |
| InChIKey | PRMYYNZDFDQLKC-HYOGKJQXSA-N |
| XLogP | 5.32 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|