C23H14ClF3N2O3S2 — CID 18871414
N-[2-chloro-5-(trifluoromethyl)phenyl]-4-[[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]methyl]benzamide (PubChem CID 18871414) has the molecular formula C23H14ClF3N2O3S2 and a molecular weight of 522.96 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-4-[[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]methyl]benzamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-[[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 18871414 |
| Molecular Formula | C23H14ClF3N2O3S2 |
| Molecular Weight | 522.96 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-[[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]methyl]benzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)c1ccc(CN2C(=O)S/C(=C\c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C23H14ClF3N2O3S2/c24-17-8-7-15(23(25,26)27)10-18(17)28-20(30)14-5-3-13(4-6-14)12-29-21(31)19(34-22(29)32)11-16-2-1-9-33-16/h1-11H,12H2,(H,28,30)/b19-11- |
| InChIKey | WIMNIBPSZPRLQO-ODLFYWEKSA-N |
| XLogP | 6.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.96 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|