About CID 18958386
CID 18958386 (PubChem CID 18958386) has the molecular formula C7H7BrSi
and a molecular weight of 199.12 g/mol.
Molecular Properties
| Compound Name | CID 18958386 |
| PubChem CID | 18958386 |
| Molecular Formula | C7H7BrSi |
| Molecular Weight | 199.12 g/mol |
| Exact Mass | 197.95 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1[Si]Br |
| InChI | InChI=1S/C7H7BrSi/c1-6-4-2-3-5-7(6)9-8/h2-5H,1H3 |
| InChIKey | SGINGBMWLBJAES-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.12 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 18958386 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18958386?
The IUPAC name of CID 18958386 (CID 18958386) is not available.
What is the SMILES notation for CID 18958386?
The canonical SMILES for CID 18958386 is Cc1ccccc1[Si]Br.
What is the InChIKey of CID 18958386?
The InChIKey is SGINGBMWLBJAES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrSi/c1-6-4-2-3-5-7(6)9-8/h2-5H,1H3.
What are the key properties of CID 18958386?
CID 18958386 has a molecular weight of 199.12 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18958386 is sourced from PubChem (CID 18958386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).