About CID 19905827
CID 19905827 (PubChem CID 19905827) has the molecular formula C7H7O2Si3
and a molecular weight of 207.39 g/mol.
Molecular Properties
| Compound Name | CID 19905827 |
| PubChem CID | 19905827 |
| Molecular Formula | C7H7O2Si3 |
| Molecular Weight | 207.39 g/mol |
| Exact Mass | 206.98 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1[Si]O[Si]O[Si] |
| InChI | InChI=1S/C7H7O2Si3/c1-6-4-2-3-5-7(6)11-9-12-8-10/h2-5H,1H3 |
| InChIKey | YPQPKZVZHFBHGA-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.39 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19905827 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19905827?
The IUPAC name of CID 19905827 (CID 19905827) is not available.
What is the SMILES notation for CID 19905827?
The canonical SMILES for CID 19905827 is Cc1ccccc1[Si]O[Si]O[Si].
What is the InChIKey of CID 19905827?
The InChIKey is YPQPKZVZHFBHGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O2Si3/c1-6-4-2-3-5-7(6)11-9-12-8-10/h2-5H,1H3.
What are the key properties of CID 19905827?
CID 19905827 has a molecular weight of 207.39 g/mol, XLogP of -0.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19905827 is sourced from PubChem (CID 19905827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).