C18H25N3O4 — CID 18967866
tert-butyl N-amino-N-[4-(4-cyano-2,6-dimethylphenoxy)butanoyl]carbamate (PubChem CID 18967866) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is tert-butyl N-amino-N-[4-(4-cyano-2,6-dimethylphenoxy)butanoyl]carbamate.
| Compound Name | tert-butyl N-amino-N-[4-(4-cyano-2,6-dimethylphenoxy)butanoyl]carbamate |
|---|---|
| PubChem CID | 18967866 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl N-amino-N-[4-(4-cyano-2,6-dimethylphenoxy)butanoyl]carbamate |
| SMILES | Cc1cc(C#N)cc(C)c1OCCCC(=O)N(N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25N3O4/c1-12-9-14(11-19)10-13(2)16(12)24-8-6-7-15(22)21(20)17(23)25-18(3,4)5/h9-10H,6-8,20H2,1-5H3 |
| InChIKey | UQHAORVMICPRKY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|