C10H16NO4P — CID 18978260
[1-amino-1-(3-ethylphenyl)-2-hydroxyethyl]phosphonic acid (PubChem CID 18978260) has the molecular formula C10H16NO4P and a molecular weight of 245.21 g/mol. Its IUPAC name is [1-amino-1-(3-ethylphenyl)-2-hydroxyethyl]phosphonic acid.
| Compound Name | [1-amino-1-(3-ethylphenyl)-2-hydroxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 18978260 |
| Molecular Formula | C10H16NO4P |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | [1-amino-1-(3-ethylphenyl)-2-hydroxyethyl]phosphonic acid |
| SMILES | CCc1cccc(C(N)(CO)P(=O)(O)O)c1 |
| InChI | InChI=1S/C10H16NO4P/c1-2-8-4-3-5-9(6-8)10(11,7-12)16(13,14)15/h3-6,12H,2,7,11H2,1H3,(H2,13,14,15) |
| InChIKey | XEIMHZRZRBBZJV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|