C12H20O7S9 — CID 19025986
tris[1,1,2-tris(sulfanyl)ethyl] 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 19025986) has the molecular formula C12H20O7S9 and a molecular weight of 564.89 g/mol. Its IUPAC name is tris[1,1,2-tris(sulfanyl)ethyl] 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | tris[1,1,2-tris(sulfanyl)ethyl] 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 19025986 |
| Molecular Formula | C12H20O7S9 |
| Molecular Weight | 564.89 g/mol |
| Exact Mass | 563.87 |
| IUPAC Name | tris[1,1,2-tris(sulfanyl)ethyl] 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | O=C(CC(O)(CC(=O)OC(S)(S)CS)C(=O)OC(S)(S)CS)OC(S)(S)CS |
| InChI | InChI=1S/C12H20O7S9/c13-6(17-10(23,24)3-20)1-9(16,8(15)19-12(27,28)5-22)2-7(14)18-11(25,26)4-21/h16,20-28H,1-5H2 |
| InChIKey | CJQLSOBQWWDTOU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.89 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|