C26H22F3N3O4S2 — CID 19252399
2-[(1S,9S)-8,8-dimethyl-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide (PubChem CID 19252399) has the molecular formula C26H22F3N3O4S2 and a molecular weight of 561.61 g/mol. Its IUPAC name is 2-[(1S,9S)-8,8-dimethyl-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(1S,9S)-8,8-dimethyl-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19252399 |
| Molecular Formula | C26H22F3N3O4S2 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.10 |
| IUPAC Name | 2-[(1S,9S)-8,8-dimethyl-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)Cn1c2c(sc1=O)C(C)(C)[C@H]1C(=O)N(c3ccccc3C(F)(F)F)C(=O)[C@H]1S2 |
| InChI | InChI=1S/C26H22F3N3O4S2/c1-13-8-4-6-10-15(13)30-17(33)12-31-23-20(38-24(31)36)25(2,3)18-19(37-23)22(35)32(21(18)34)16-11-7-5-9-14(16)26(27,28)29/h4-11,18-19H,12H2,1-3H3,(H,30,33)/t18-,19+/m1/s1 |
| InChIKey | KMUQNIRHMKAGBO-MOPGFXCFSA-N |
| XLogP | 4.82 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|