C26H25N3O4S2 — CID 19252254
2-[(1S,9S)-8,8-dimethyl-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide (PubChem CID 19252254) has the molecular formula C26H25N3O4S2 and a molecular weight of 507.64 g/mol. Its IUPAC name is 2-[(1S,9S)-8,8-dimethyl-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(1S,9S)-8,8-dimethyl-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19252254 |
| Molecular Formula | C26H25N3O4S2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 2-[(1S,9S)-8,8-dimethyl-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1ccc(N2C(=O)[C@H]3Sc4c(sc(=O)n4CC(=O)Nc4cccc(C)c4)C(C)(C)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C26H25N3O4S2/c1-14-8-10-17(11-9-14)29-22(31)19-20(23(29)32)34-24-21(26(19,3)4)35-25(33)28(24)13-18(30)27-16-7-5-6-15(2)12-16/h5-12,19-20H,13H2,1-4H3,(H,27,30)/t19-,20+/m1/s1 |
| InChIKey | PJZDCEHZBOHMOF-UXHICEINSA-N |
| XLogP | 4.11 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|