C29H25N3O5S2 — CID 19252366
2-[(1S,9S)-11-(4-methoxyphenyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide (PubChem CID 19252366) has the molecular formula C29H25N3O5S2 and a molecular weight of 559.67 g/mol. Its IUPAC name is 2-[(1S,9S)-11-(4-methoxyphenyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[(1S,9S)-11-(4-methoxyphenyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 19252366 |
| Molecular Formula | C29H25N3O5S2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | 2-[(1S,9S)-11-(4-methoxyphenyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
| SMILES | COc1ccc(N2C(=O)[C@H]3Sc4c(sc(=O)n4CC(=O)Nc4ccc5ccccc5c4)C(C)(C)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C29H25N3O5S2/c1-29(2)22-23(26(35)32(25(22)34)19-10-12-20(37-3)13-11-19)38-27-24(29)39-28(36)31(27)15-21(33)30-18-9-8-16-6-4-5-7-17(16)14-18/h4-14,22-23H,15H2,1-3H3,(H,30,33)/t22-,23+/m1/s1 |
| InChIKey | UHUIZQMZTDZTIT-PKTZIBPZSA-N |
| XLogP | 4.65 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|