C25H22ClN3O4S2 — CID 19252243
N-(4-chlorophenyl)-2-[(1S,9S)-8,8-dimethyl-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 19252243) has the molecular formula C25H22ClN3O4S2 and a molecular weight of 528.06 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(1S,9S)-8,8-dimethyl-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(1S,9S)-8,8-dimethyl-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 19252243 |
| Molecular Formula | C25H22ClN3O4S2 |
| Molecular Weight | 528.06 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(1S,9S)-8,8-dimethyl-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | Cc1ccc(N2C(=O)[C@H]3Sc4c(sc(=O)n4CC(=O)Nc4ccc(Cl)cc4)C(C)(C)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C25H22ClN3O4S2/c1-13-4-10-16(11-5-13)29-21(31)18-19(22(29)32)34-23-20(25(18,2)3)35-24(33)28(23)12-17(30)27-15-8-6-14(26)7-9-15/h4-11,18-19H,12H2,1-3H3,(H,27,30)/t18-,19+/m1/s1 |
| InChIKey | ZDUOZLFLQBURCJ-MOPGFXCFSA-N |
| XLogP | 4.45 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.06 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|