C28H22ClN3O4S2 — CID 19252294
2-[(1S,9S)-11-(4-chlorophenyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide (PubChem CID 19252294) has the molecular formula C28H22ClN3O4S2 and a molecular weight of 564.09 g/mol. Its IUPAC name is 2-[(1S,9S)-11-(4-chlorophenyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[(1S,9S)-11-(4-chlorophenyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 19252294 |
| Molecular Formula | C28H22ClN3O4S2 |
| Molecular Weight | 564.09 g/mol |
| Exact Mass | 563.07 |
| IUPAC Name | 2-[(1S,9S)-11-(4-chlorophenyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
| SMILES | CC1(C)c2sc(=O)n(CC(=O)Nc3ccc4ccccc4c3)c2S[C@@H]2C(=O)N(c3ccc(Cl)cc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C28H22ClN3O4S2/c1-28(2)21-22(25(35)32(24(21)34)19-11-8-17(29)9-12-19)37-26-23(28)38-27(36)31(26)14-20(33)30-18-10-7-15-5-3-4-6-16(15)13-18/h3-13,21-22H,14H2,1-2H3,(H,30,33)/t21-,22+/m1/s1 |
| InChIKey | CWDALVOILHRDBO-YADHBBJMSA-N |
| XLogP | 5.30 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.09 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|